C11H15FO2S — CID 91157263
6-ethyl-7-fluoro-3-methylsulfonylocta-1,2,4,6-tetraene (PubChem CID 91157263) has the molecular formula C11H15FO2S and a molecular weight of 230.30 g/mol. Its IUPAC name is 6-ethyl-7-fluoro-3-methylsulfonylocta-1,2,4,6-tetraene.
| Compound Name | 6-ethyl-7-fluoro-3-methylsulfonylocta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 91157263 |
| Molecular Formula | C11H15FO2S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 6-ethyl-7-fluoro-3-methylsulfonylocta-1,2,4,6-tetraene |
| SMILES | C=C=C(C=CC(CC)=C(C)F)S(C)(=O)=O |
| InChI | InChI=1S/C11H15FO2S/c1-5-10(9(3)12)7-8-11(6-2)15(4,13)14/h7-8H,2,5H2,1,3-4H3 |
| InChIKey | NKWGFOLRLRQOPK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|