About 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride
4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride (PubChem CID 91157383) has the molecular formula C12H18F6N3O2P
and a molecular weight of 381.26 g/mol. Its IUPAC name is 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride.
Molecular Properties
| Compound Name | 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride |
| PubChem CID | 91157383 |
| Molecular Formula | C12H18F6N3O2P |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride |
| SMILES | CCOc1cc(N(C)C)c(OCC)cc1[N+]#N.FP(F)(F)(F)F.[F-] |
| InChI | InChI=1S/C12H18N3O2.F5P.FH/c1-5-16-11-8-10(15(3)4)12(17-6-2)7-9(11)14-13;1-6(2,3,4)5;/h7-8H,5-6H2,1-4H3;;1H/q+1;;/p-1 |
| InChIKey | XOFRQKIYVOGIIW-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride?
The IUPAC name of 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride (CID 91157383) is 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride.
What is the SMILES notation for 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride?
The canonical SMILES for 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride is CCOc1cc(N(C)C)c(OCC)cc1[N+]#N.FP(F)(F)(F)F.[F-].
What is the InChIKey of 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride?
The InChIKey is XOFRQKIYVOGIIW-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H18N3O2.F5P.FH/c1-5-16-11-8-10(15(3)4)12(17-6-2)7-9(11)14-13;1-6(2,3,4)5;/h7-8H,5-6H2,1-4H3;;1H/q+1;;/p-1.
What are the key properties of 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride?
4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride has a molecular weight of 381.26 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-2,5-diethoxybenzenediazonium;pentafluoro-λ5-phosphane;fluoride is sourced from PubChem (CID 91157383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).