C17H10Cl4N2O2 — CID 91158209
2,2-dichloro-N-[2-(2,6-dichlorophenyl)-5-(1,3-oxazol-2-yl)phenyl]acetamide (PubChem CID 91158209) has the molecular formula C17H10Cl4N2O2 and a molecular weight of 416.09 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(2,6-dichlorophenyl)-5-(1,3-oxazol-2-yl)phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[2-(2,6-dichlorophenyl)-5-(1,3-oxazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 91158209 |
| Molecular Formula | C17H10Cl4N2O2 |
| Molecular Weight | 416.09 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 2,2-dichloro-N-[2-(2,6-dichlorophenyl)-5-(1,3-oxazol-2-yl)phenyl]acetamide |
| SMILES | O=C(Nc1cc(-c2ncco2)ccc1-c1c(Cl)cccc1Cl)C(Cl)Cl |
| InChI | InChI=1S/C17H10Cl4N2O2/c18-11-2-1-3-12(19)14(11)10-5-4-9(17-22-6-7-25-17)8-13(10)23-16(24)15(20)21/h1-8,15H,(H,23,24) |
| InChIKey | YOFNOBWWCWLNCQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.09 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|