About (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine
(4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine (PubChem CID 91158217) has the molecular formula C7H12N2O2S2
and a molecular weight of 220.32 g/mol. Its IUPAC name is (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine.
Molecular Properties
| Compound Name | (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine |
| PubChem CID | 91158217 |
| Molecular Formula | C7H12N2O2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine |
| SMILES | CC(C)S(=O)(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C7H12N2O2S2/c1-5(2)13(10,11)7-4-12-6(3-8)9-7/h4-5H,3,8H2,1-2H3 |
| InChIKey | WCGNDFKIBWSLKG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine?
The IUPAC name of (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine (CID 91158217) is (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine.
What is the SMILES notation for (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine?
The canonical SMILES for (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine is CC(C)S(=O)(=O)c1csc(CN)n1.
What is the InChIKey of (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine?
The InChIKey is WCGNDFKIBWSLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S2/c1-5(2)13(10,11)7-4-12-6(3-8)9-7/h4-5H,3,8H2,1-2H3.
What are the key properties of (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine?
(4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine has a molecular weight of 220.32 g/mol, XLogP of 0.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propan-2-ylsulfonyl-1,3-thiazol-2-yl)methanamine is sourced from PubChem (CID 91158217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).