About 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol
4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol (PubChem CID 91158282) has the molecular formula C19H18F3N3O2S
and a molecular weight of 409.43 g/mol. Its IUPAC name is 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol.
Molecular Properties
| Compound Name | 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol |
| PubChem CID | 91158282 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol |
| SMILES | Oc1ccc(N2CCN(Cc3ccccc3OC(F)(F)F)CC2)c2ncsc12 |
| InChI | InChI=1S/C19H18F3N3O2S/c20-19(21,22)27-16-4-2-1-3-13(16)11-24-7-9-25(10-8-24)14-5-6-15(26)18-17(14)23-12-28-18/h1-6,12,26H,7-11H2 |
| InChIKey | MOFSGSSSBLPDBQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol?
The IUPAC name of 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol (CID 91158282) is 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol.
What is the SMILES notation for 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol?
The canonical SMILES for 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol is Oc1ccc(N2CCN(Cc3ccccc3OC(F)(F)F)CC2)c2ncsc12.
What is the InChIKey of 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol?
The InChIKey is MOFSGSSSBLPDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F3N3O2S/c20-19(21,22)27-16-4-2-1-3-13(16)11-24-7-9-25(10-8-24)14-5-6-15(26)18-17(14)23-12-28-18/h1-6,12,26H,7-11H2.
What are the key properties of 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol?
4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol has a molecular weight of 409.43 g/mol, XLogP of 4.22, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[2-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-7-ol is sourced from PubChem (CID 91158282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).