About 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine
1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine (PubChem CID 91158691) has the molecular formula C24H25N3S
and a molecular weight of 387.55 g/mol. Its IUPAC name is 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine.
Molecular Properties
| Compound Name | 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine |
| PubChem CID | 91158691 |
| Molecular Formula | C24H25N3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine |
| SMILES | [H]/N=C1\CC(c2sc(CC)nc2-c2cccc(C)c2)=CCN1Cc1ccccc1 |
| InChI | InChI=1S/C24H25N3S/c1-3-22-26-23(19-11-7-8-17(2)14-19)24(28-22)20-12-13-27(21(25)15-20)16-18-9-5-4-6-10-18/h4-12,14,25H,3,13,15-16H2,1-2H3/b25-21+ |
| InChIKey | OCCPYRQCRWOJDO-NJNXFGOHSA-N |
| XLogP | 5.95 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine?
The IUPAC name of 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine (CID 91158691) is 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine.
What is the SMILES notation for 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine?
The canonical SMILES for 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine is [H]/N=C1\CC(c2sc(CC)nc2-c2cccc(C)c2)=CCN1Cc1ccccc1.
What is the InChIKey of 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine?
The InChIKey is OCCPYRQCRWOJDO-NJNXFGOHSA-N. The full InChI is InChI=1S/C24H25N3S/c1-3-22-26-23(19-11-7-8-17(2)14-19)24(28-22)20-12-13-27(21(25)15-20)16-18-9-5-4-6-10-18/h4-12,14,25H,3,13,15-16H2,1-2H3/b25-21+.
What are the key properties of 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine?
1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine has a molecular weight of 387.55 g/mol, XLogP of 5.95, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]-2,5-dihydropyridin-6-imine is sourced from PubChem (CID 91158691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).