C28H36F3N3O5S — CID 91158858
N-[5-tert-butyl-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazol-2-ylidene]-2-[2-(oxan-2-yloxyamino)prop-1-enoxy]-5-(trifluoromethyl)benzamide (PubChem CID 91158858) has the molecular formula C28H36F3N3O5S and a molecular weight of 583.67 g/mol. Its IUPAC name is N-[5-tert-butyl-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazol-2-ylidene]-2-[2-(oxan-2-yloxyamino)prop-1-enoxy]-5-(trifluoromethyl)benzamide.
| Compound Name | N-[5-tert-butyl-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazol-2-ylidene]-2-[2-(oxan-2-yloxyamino)prop-1-enoxy]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91158858 |
| Molecular Formula | C28H36F3N3O5S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | N-[5-tert-butyl-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazol-2-ylidene]-2-[2-(oxan-2-yloxyamino)prop-1-enoxy]-5-(trifluoromethyl)benzamide |
| SMILES | CC(=COc1ccc(C(F)(F)F)cc1C(=O)/N=c1/sc(C(C)(C)C)cn1C[C@H]1CCCO1)NOC1CCCCO1 |
| InChI | InChI=1S/C28H36F3N3O5S/c1-18(33-39-24-9-5-6-12-37-24)17-38-22-11-10-19(28(29,30)31)14-21(22)25(35)32-26-34(15-20-8-7-13-36-20)16-23(40-26)27(2,3)4/h10-11,14,16-17,20,24,33H,5-9,12-13,15H2,1-4H3/b18-17?,32-26+/t20-,24?/m1/s1 |
| InChIKey | YJBBVGRORNUWKS-CPXVOEIJSA-N |
| XLogP | 6.07 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|