C30H24N9O6P3 — CID 91159326
1,2,2,4,5,6-hexapyridin-2-yloxy-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene (PubChem CID 91159326) has the molecular formula C30H24N9O6P3 and a molecular weight of 699.50 g/mol. Its IUPAC name is 1,2,2,4,5,6-hexapyridin-2-yloxy-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene.
| Compound Name | 1,2,2,4,5,6-hexapyridin-2-yloxy-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene |
|---|---|
| PubChem CID | 91159326 |
| Molecular Formula | C30H24N9O6P3 |
| Molecular Weight | 699.50 g/mol |
| Exact Mass | 699.11 |
| IUPAC Name | 1,2,2,4,5,6-hexapyridin-2-yloxy-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene |
| SMILES | c1ccc(ON2P(Oc3ccccn3)N=P(Oc3ccccn3)(Oc3ccccn3)N(Oc3ccccn3)P2Oc2ccccn2)nc1 |
| InChI | InChI=1S/C30H24N9O6P3/c1-7-19-31-25(13-1)40-38-46(42-27-15-3-9-21-33-27)37-48(44-29-17-5-11-23-35-29,45-30-18-6-12-24-36-30)39(41-26-14-2-8-20-32-26)47(38)43-28-16-4-10-22-34-28/h1-24H |
| InChIKey | IHRNGBIPKPCIQT-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 151.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.50 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|