C44H81NO3 — CID 91159769
[4-(diethylamino)-2-octadeca-9,12-dienoxybutyl] octadeca-9,12-dienoate (PubChem CID 91159769) has the molecular formula C44H81NO3 and a molecular weight of 672.14 g/mol. Its IUPAC name is [4-(diethylamino)-2-octadeca-9,12-dienoxybutyl] octadeca-9,12-dienoate.
| Compound Name | [4-(diethylamino)-2-octadeca-9,12-dienoxybutyl] octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 91159769 |
| Molecular Formula | C44H81NO3 |
| Molecular Weight | 672.14 g/mol |
| Exact Mass | 671.62 |
| IUPAC Name | [4-(diethylamino)-2-octadeca-9,12-dienoxybutyl] octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC(CCN(CC)CC)COC(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C44H81NO3/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41-47-43(39-40-45(7-3)8-4)42-48-44(46)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h15-18,21-24,43H,5-14,19-20,25-42H2,1-4H3 |
| InChIKey | KPOVWVRTCZXHQG-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.14 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|