About ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate
ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate (PubChem CID 91159929) has the molecular formula C19H32O4Si
and a molecular weight of 352.55 g/mol. Its IUPAC name is ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate |
| PubChem CID | 91159929 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate |
| SMILES | C=CC[C@H]1C(O[Si](C)(C)C(C)(C)C)=CCC(=O)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C19H32O4Si/c1-8-10-14-15(13-18(21)22-9-2)16(20)11-12-17(14)23-24(6,7)19(3,4)5/h8,12,14-15H,1,9-11,13H2,2-7H3/t14-,15-/m1/s1 |
| InChIKey | SZEFFCZQTCQDFG-HUUCEWRRSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate?
The IUPAC name of ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate (CID 91159929) is ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate.
What is the SMILES notation for ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate?
The canonical SMILES for ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate is C=CC[C@H]1C(O[Si](C)(C)C(C)(C)C)=CCC(=O)[C@@H]1CC(=O)OCC.
What is the InChIKey of ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate?
The InChIKey is SZEFFCZQTCQDFG-HUUCEWRRSA-N. The full InChI is InChI=1S/C19H32O4Si/c1-8-10-14-15(13-18(21)22-9-2)16(20)11-12-17(14)23-24(6,7)19(3,4)5/h8,12,14-15H,1,9-11,13H2,2-7H3/t14-,15-/m1/s1.
What are the key properties of ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate?
ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate has a molecular weight of 352.55 g/mol, XLogP of 4.63, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-prop-2-enylcyclohex-3-en-1-yl]acetate is sourced from PubChem (CID 91159929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).