C40H74O2Si2 — CID 91160643
but-3-enyl-[[1-[2-[2-[but-3-enyl-di(propan-2-yl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]oxy]-di(propan-2-yl)silane (PubChem CID 91160643) has the molecular formula C40H74O2Si2 and a molecular weight of 643.20 g/mol. Its IUPAC name is but-3-enyl-[[1-[2-[2-[but-3-enyl-di(propan-2-yl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]oxy]-di(propan-2-yl)silane.
| Compound Name | but-3-enyl-[[1-[2-[2-[but-3-enyl-di(propan-2-yl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]oxy]-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 91160643 |
| Molecular Formula | C40H74O2Si2 |
| Molecular Weight | 643.20 g/mol |
| Exact Mass | 642.52 |
| IUPAC Name | but-3-enyl-[[1-[2-[2-[but-3-enyl-di(propan-2-yl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]oxy]-di(propan-2-yl)silane |
| SMILES | C=CCC[Si](OC1CC2CCCCC2C1CCC1C(O[Si](CCC=C)(C(C)C)C(C)C)CC2CCCCC21)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H74O2Si2/c1-11-13-25-43(29(3)4,30(5)6)41-39-27-33-19-15-17-21-35(33)37(39)23-24-38-36-22-18-16-20-34(36)28-40(38)42-44(31(7)8,32(9)10)26-14-12-2/h11-12,29-40H,1-2,13-28H2,3-10H3 |
| InChIKey | HRTUJWSAEABJLH-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.20 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|