C11H14N2O3 — CID 91160673
2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]butanoic acid (PubChem CID 91160673) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]butanoic acid.
| Compound Name | 2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 91160673 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-[(3-cyano-4,5-dimethylfuran-2-yl)amino]butanoic acid |
| SMILES | CCC(Nc1oc(C)c(C)c1C#N)C(=O)O |
| InChI | InChI=1S/C11H14N2O3/c1-4-9(11(14)15)13-10-8(5-12)6(2)7(3)16-10/h9,13H,4H2,1-3H3,(H,14,15) |
| InChIKey | PSQHOOITXYZSHH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |