About 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane
3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane (PubChem CID 91160759) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane.
Molecular Properties
| Compound Name | 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane |
| PubChem CID | 91160759 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane |
| SMILES | CC=C(C)C12CC3CC(C)(CC1(C)C3)C2 |
| InChI | InChI=1S/C15H24/c1-5-11(2)15-8-12-6-13(3,10-15)9-14(15,4)7-12/h5,12H,6-10H2,1-4H3 |
| InChIKey | ZWQXMJVFAPVQSD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane?
The IUPAC name of 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane (CID 91160759) is 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane.
What is the SMILES notation for 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane?
The canonical SMILES for 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane is CC=C(C)C12CC3CC(C)(CC1(C)C3)C2.
What is the InChIKey of 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane?
The InChIKey is ZWQXMJVFAPVQSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24/c1-5-11(2)15-8-12-6-13(3,10-15)9-14(15,4)7-12/h5,12H,6-10H2,1-4H3.
What are the key properties of 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane?
3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane has a molecular weight of 204.36 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-en-2-yl-1,7-dimethyltricyclo[3.3.1.03,7]nonane is sourced from PubChem (CID 91160759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).