C21H32NO4+ — CID 91160839
[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]oxy-dimethylazanium (PubChem CID 91160839) has the molecular formula C21H32NO4+ and a molecular weight of 362.49 g/mol. Its IUPAC name is [(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]oxy-dimethylazanium.
| Compound Name | [(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]oxy-dimethylazanium |
|---|---|
| PubChem CID | 91160839 |
| Molecular Formula | C21H32NO4+ |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | [(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]oxy-dimethylazanium |
| SMILES | CC(C)=C[C@@H]1[C@@H](C(=O)O[N+](C)(C)[C@H](CO)[C@H](O)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C21H32NO4/c1-14(2)12-16-18(21(16,3)4)20(25)26-22(5,6)17(13-23)19(24)15-10-8-7-9-11-15/h7-12,16-19,23-24H,13H2,1-6H3/q+1/t16-,17-,18+,19-/m1/s1 |
| InChIKey | HXHPGVRUVBHOCO-AKHDSKFASA-N |
| XLogP | 2.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|