C20H39N — CID 91161176
N-butyl-8-tert-butyl-5-methylundeca-7,10-dien-1-amine (PubChem CID 91161176) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is N-butyl-8-tert-butyl-5-methylundeca-7,10-dien-1-amine.
| Compound Name | N-butyl-8-tert-butyl-5-methylundeca-7,10-dien-1-amine |
|---|---|
| PubChem CID | 91161176 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | N-butyl-8-tert-butyl-5-methylundeca-7,10-dien-1-amine |
| SMILES | C=CCC(=CCC(C)CCCCNCCCC)C(C)(C)C |
| InChI | InChI=1S/C20H39N/c1-7-9-16-21-17-11-10-13-18(3)14-15-19(12-8-2)20(4,5)6/h8,15,18,21H,2,7,9-14,16-17H2,1,3-6H3 |
| InChIKey | VFXOUAGIZLQXLD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|