C25H25FN2O4 — CID 91161223
4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 91161223) has the molecular formula C25H25FN2O4 and a molecular weight of 436.48 g/mol. Its IUPAC name is 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 91161223 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1ccc(Oc2cnc3cc(F)ccc3n2)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C25H25FN2O4/c1-6-14-7-9-16(31-20-13-27-19-11-15(26)8-10-18(19)28-20)12-17(14)21-22(29)24(2,3)32-25(4,5)23(21)30/h7-13,21H,6H2,1-5H3 |
| InChIKey | STSIGTFRNITGJN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|