C11H17NO — CID 91161907
3,7-dimethylidene-1,2,4,4a,5,6,8,8a-octahydroquinolin-6-ol (PubChem CID 91161907) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 3,7-dimethylidene-1,2,4,4a,5,6,8,8a-octahydroquinolin-6-ol.
| Compound Name | 3,7-dimethylidene-1,2,4,4a,5,6,8,8a-octahydroquinolin-6-ol |
|---|---|
| PubChem CID | 91161907 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3,7-dimethylidene-1,2,4,4a,5,6,8,8a-octahydroquinolin-6-ol |
| SMILES | C=C1CNC2CC(=C)C(O)CC2C1 |
| InChI | InChI=1S/C11H17NO/c1-7-3-9-5-11(13)8(2)4-10(9)12-6-7/h9-13H,1-6H2 |
| InChIKey | WCRRGCAKLYOERR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|