C19H28O2 — CID 91161957
(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 91161957) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91161957 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)CC1CC[C@@H]1[C@H]2CC[C@]2(C)C(O)C=C[C@@H]12 |
| InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h5-6,12,14-17,21H,3-4,7-11H2,1-2H3/t12?,14-,15-,16+,17?,18-,19-/m0/s1 |
| InChIKey | RKCQAVHBDVAZFX-KEEPPZAFSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|