C17H13F17O4 — CID 91162272
2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl)-3-propan-2-ylbut-2-enedioic acid (PubChem CID 91162272) has the molecular formula C17H13F17O4 and a molecular weight of 604.25 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl)-3-propan-2-ylbut-2-enedioic acid.
| Compound Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl)-3-propan-2-ylbut-2-enedioic acid |
|---|---|
| PubChem CID | 91162272 |
| Molecular Formula | C17H13F17O4 |
| Molecular Weight | 604.25 g/mol |
| Exact Mass | 604.05 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl)-3-propan-2-ylbut-2-enedioic acid |
| SMILES | CC(C)C(C(=O)O)=C(C(=O)O)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H13F17O4/c1-4(2)6(8(35)36)7(9(37)38)5(3)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h4-5H,1-3H3,(H,35,36)(H,37,38) |
| InChIKey | MCDBJZNUWOOJNQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.25 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|