About methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate
methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate (PubChem CID 91162561) has the molecular formula C25H24N2O5S
and a molecular weight of 464.54 g/mol. Its IUPAC name is methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate.
Molecular Properties
| Compound Name | methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate |
| PubChem CID | 91162561 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N(c2ccccc2)c2nc3cc(C)ccc3o2)ccc1C(C)C |
| InChI | InChI=1S/C25H24N2O5S/c1-16(2)20-12-11-19(15-21(20)24(28)31-4)33(29,30)27(18-8-6-5-7-9-18)25-26-22-14-17(3)10-13-23(22)32-25/h5-16H,1-4H3 |
| InChIKey | BEDVNLNZZURUQZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate?
The IUPAC name of methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate (CID 91162561) is methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate.
What is the SMILES notation for methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate?
The canonical SMILES for methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate is COC(=O)c1cc(S(=O)(=O)N(c2ccccc2)c2nc3cc(C)ccc3o2)ccc1C(C)C.
What is the InChIKey of methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate?
The InChIKey is BEDVNLNZZURUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O5S/c1-16(2)20-12-11-19(15-21(20)24(28)31-4)33(29,30)27(18-8-6-5-7-9-18)25-26-22-14-17(3)10-13-23(22)32-25/h5-16H,1-4H3.
What are the key properties of methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate?
methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate has a molecular weight of 464.54 g/mol, XLogP of 5.57, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(5-methyl-1,3-benzoxazol-2-yl)-phenylsulfamoyl]-2-propan-2-ylbenzoate is sourced from PubChem (CID 91162561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).