C21H36N2O3 — CID 91162775
tert-butyl N-[(2S,3R)-3-hydroxy-4-[methyl(prop-2-enyl)amino]-1-phenylbutan-2-yl]carbamate;ethane (PubChem CID 91162775) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-4-[methyl(prop-2-enyl)amino]-1-phenylbutan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[methyl(prop-2-enyl)amino]-1-phenylbutan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 91162775 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[methyl(prop-2-enyl)amino]-1-phenylbutan-2-yl]carbamate;ethane |
| SMILES | C=CCN(C)C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C19H30N2O3.C2H6/c1-6-12-21(5)14-17(22)16(13-15-10-8-7-9-11-15)20-18(23)24-19(2,3)4;1-2/h6-11,16-17,22H,1,12-14H2,2-5H3,(H,20,23);1-2H3/t16-,17+;/m0./s1 |
| InChIKey | XSEZBPRCDHGIGR-MCJVGQIASA-N |
| XLogP | 3.63 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|