C12H26O4Si — CID 91163027
ethyl (3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate (PubChem CID 91163027) has the molecular formula C12H26O4Si and a molecular weight of 262.42 g/mol. Its IUPAC name is ethyl (3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate.
| Compound Name | ethyl (3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate |
|---|---|
| PubChem CID | 91163027 |
| Molecular Formula | C12H26O4Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | ethyl (3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate |
| SMILES | CCOC(=O)C(O[Si](C)(C)C(C)(C)C)[C@H](C)O |
| InChI | InChI=1S/C12H26O4Si/c1-8-15-11(14)10(9(2)13)16-17(6,7)12(3,4)5/h9-10,13H,8H2,1-7H3/t9-,10?/m0/s1 |
| InChIKey | IQGDSKMLIXENKO-RGURZIINSA-N |
| XLogP | 2.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|