C12H22O6 — CID 91163460
2,2-bis(hydroxymethyl)dec-3-yne-1,5,6,10-tetrol (PubChem CID 91163460) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)dec-3-yne-1,5,6,10-tetrol.
| Compound Name | 2,2-bis(hydroxymethyl)dec-3-yne-1,5,6,10-tetrol |
|---|---|
| PubChem CID | 91163460 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2,2-bis(hydroxymethyl)dec-3-yne-1,5,6,10-tetrol |
| SMILES | OCCCCC(O)C(O)C#CC(CO)(CO)CO |
| InChI | InChI=1S/C12H22O6/c13-6-2-1-3-10(17)11(18)4-5-12(7-14,8-15)9-16/h10-11,13-18H,1-3,6-9H2 |
| InChIKey | DMMUJYCGUVMHFE-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|