C27H19N5O12 — CID 91164150
3-hydroxyfuro[3,4-b]pyridine-5,7-dione;bis(methyl 3,8-dihydroxy-1,6-naphthyridine-7-carboxylate) (PubChem CID 91164150) has the molecular formula C27H19N5O12 and a molecular weight of 605.47 g/mol. Its IUPAC name is 3-hydroxyfuro[3,4-b]pyridine-5,7-dione;bis(methyl 3,8-dihydroxy-1,6-naphthyridine-7-carboxylate).
| Compound Name | 3-hydroxyfuro[3,4-b]pyridine-5,7-dione;bis(methyl 3,8-dihydroxy-1,6-naphthyridine-7-carboxylate) |
|---|---|
| PubChem CID | 91164150 |
| Molecular Formula | C27H19N5O12 |
| Molecular Weight | 605.47 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | 3-hydroxyfuro[3,4-b]pyridine-5,7-dione;bis(methyl 3,8-dihydroxy-1,6-naphthyridine-7-carboxylate) |
| SMILES | COC(=O)c1ncc2cc(O)cnc2c1O.COC(=O)c1ncc2cc(O)cnc2c1O.O=C1OC(=O)c2ncc(O)cc21 |
| InChI | InChI=1S/2C10H8N2O4.C7H3NO4/c2*1-16-10(15)8-9(14)7-5(3-11-8)2-6(13)4-12-7;9-3-1-4-5(8-2-3)7(11)12-6(4)10/h2*2-4,13-14H,1H3;1-2,9H |
| InChIKey | YLEZHTJAPHASDV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 261.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|