C17H13F2NO4 — CID 91164233
4-[4-fluoro-N-[(4-fluorophenyl)methyl]anilino]-2,4-dioxobutanoic acid (PubChem CID 91164233) has the molecular formula C17H13F2NO4 and a molecular weight of 333.29 g/mol. Its IUPAC name is 4-[4-fluoro-N-[(4-fluorophenyl)methyl]anilino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[4-fluoro-N-[(4-fluorophenyl)methyl]anilino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 91164233 |
| Molecular Formula | C17H13F2NO4 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-[4-fluoro-N-[(4-fluorophenyl)methyl]anilino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(Cc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F2NO4/c18-12-3-1-11(2-4-12)10-20(14-7-5-13(19)6-8-14)16(22)9-15(21)17(23)24/h1-8H,9-10H2,(H,23,24) |
| InChIKey | DGWREQJZFFRKKW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|