C33H35FN2O2 — CID 91164375
4-[2-(dibenzylamino)ethoxy]-3-(2-fluorophenyl)-N-(2-methylpropyl)benzamide (PubChem CID 91164375) has the molecular formula C33H35FN2O2 and a molecular weight of 510.65 g/mol. Its IUPAC name is 4-[2-(dibenzylamino)ethoxy]-3-(2-fluorophenyl)-N-(2-methylpropyl)benzamide.
| Compound Name | 4-[2-(dibenzylamino)ethoxy]-3-(2-fluorophenyl)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 91164375 |
| Molecular Formula | C33H35FN2O2 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 4-[2-(dibenzylamino)ethoxy]-3-(2-fluorophenyl)-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1ccc(OCCN(Cc2ccccc2)Cc2ccccc2)c(-c2ccccc2F)c1 |
| InChI | InChI=1S/C33H35FN2O2/c1-25(2)22-35-33(37)28-17-18-32(30(21-28)29-15-9-10-16-31(29)34)38-20-19-36(23-26-11-5-3-6-12-26)24-27-13-7-4-8-14-27/h3-18,21,25H,19-20,22-24H2,1-2H3,(H,35,37) |
| InChIKey | HKJJLBWLFFYAGJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |