About 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol
2,6-dibromo-4-(1,3-thiazol-4-yl)phenol (PubChem CID 91164577) has the molecular formula C9H5Br2NOS
and a molecular weight of 335.02 g/mol. Its IUPAC name is 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol.
Molecular Properties
| Compound Name | 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol |
| PubChem CID | 91164577 |
| Molecular Formula | C9H5Br2NOS |
| Molecular Weight | 335.02 g/mol |
| Exact Mass | 332.85 |
| IUPAC Name | 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol |
| SMILES | Oc1c(Br)cc(-c2cscn2)cc1Br |
| InChI | InChI=1S/C9H5Br2NOS/c10-6-1-5(2-7(11)9(6)13)8-3-14-4-12-8/h1-4,13H |
| InChIKey | LOAZEWOVHKDRCZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.02 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol?
The IUPAC name of 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol (CID 91164577) is 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol.
What is the SMILES notation for 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol?
The canonical SMILES for 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol is Oc1c(Br)cc(-c2cscn2)cc1Br.
What is the InChIKey of 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol?
The InChIKey is LOAZEWOVHKDRCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2NOS/c10-6-1-5(2-7(11)9(6)13)8-3-14-4-12-8/h1-4,13H.
What are the key properties of 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol?
2,6-dibromo-4-(1,3-thiazol-4-yl)phenol has a molecular weight of 335.02 g/mol, XLogP of 4.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-(1,3-thiazol-4-yl)phenol is sourced from PubChem (CID 91164577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).