C24H17N3O9S2 — CID 91164762
4-[2-[[5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-hydroxybenzoyl]amino]ethylsulfanyl]pyridine-2,6-dicarboxylic acid (PubChem CID 91164762) has the molecular formula C24H17N3O9S2 and a molecular weight of 555.55 g/mol. Its IUPAC name is 4-[2-[[5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-hydroxybenzoyl]amino]ethylsulfanyl]pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-[2-[[5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-hydroxybenzoyl]amino]ethylsulfanyl]pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 91164762 |
| Molecular Formula | C24H17N3O9S2 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | 4-[2-[[5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-hydroxybenzoyl]amino]ethylsulfanyl]pyridine-2,6-dicarboxylic acid |
| SMILES | O=C1NC(=O)C(=Cc2ccc(-c3ccc(O)c(C(=O)NCCSc4cc(C(=O)O)nc(C(=O)O)c4)c3)o2)S1 |
| InChI | InChI=1S/C24H17N3O9S2/c28-17-3-1-11(18-4-2-12(36-18)8-19-21(30)27-24(35)38-19)7-14(17)20(29)25-5-6-37-13-9-15(22(31)32)26-16(10-13)23(33)34/h1-4,7-10,28H,5-6H2,(H,25,29)(H,31,32)(H,33,34)(H,27,30,35) |
| InChIKey | AZLNVWRJGLJYQB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 196.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|