C23H19ClF3N3O4 — CID 91164774
2-[3-chloro-4-(trifluoromethyl)phenyl]-N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]acetamide (PubChem CID 91164774) has the molecular formula C23H19ClF3N3O4 and a molecular weight of 493.87 g/mol. Its IUPAC name is 2-[3-chloro-4-(trifluoromethyl)phenyl]-N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]acetamide.
| Compound Name | 2-[3-chloro-4-(trifluoromethyl)phenyl]-N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 91164774 |
| Molecular Formula | C23H19ClF3N3O4 |
| Molecular Weight | 493.87 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-[3-chloro-4-(trifluoromethyl)phenyl]-N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]acetamide |
| SMILES | O=C(Cc1ccc(C(F)(F)F)c(Cl)c1)NCc1ccc2c(O)n(C3CCC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C23H19ClF3N3O4/c24-17-8-12(2-4-16(17)23(25,26)27)9-20(32)28-10-13-1-3-15-14(7-13)11-30(22(15)34)18-5-6-19(31)29-21(18)33/h1-4,7-8,11,18,34H,5-6,9-10H2,(H,28,32)(H,29,31,33) |
| InChIKey | RNJZSDJQMPVBOS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|