C28H21BrN4O3S2 — CID 91164847
5-[[4-(4-bromophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91164847) has the molecular formula C28H21BrN4O3S2 and a molecular weight of 605.54 g/mol. Its IUPAC name is 5-[[4-(4-bromophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-(4-bromophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91164847 |
| Molecular Formula | C28H21BrN4O3S2 |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 604.02 |
| IUPAC Name | 5-[[4-(4-bromophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN(C)c1nc(-c2ccc(Br)cc2)c(C=C2C(=O)NC(=S)N(c3ccc(Oc4ccccc4)cc3)C2=O)s1 |
| InChI | InChI=1S/C28H21BrN4O3S2/c1-32(2)28-30-24(17-8-10-18(29)11-9-17)23(38-28)16-22-25(34)31-27(37)33(26(22)35)19-12-14-21(15-13-19)36-20-6-4-3-5-7-20/h3-16H,1-2H3,(H,31,34,37) |
| InChIKey | QSIYKLZUVXLBIH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|