C10H20O2 — CID 91164934
8-hydroxy-2,7-dimethyloctan-4-one (PubChem CID 91164934) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 8-hydroxy-2,7-dimethyloctan-4-one.
| Compound Name | 8-hydroxy-2,7-dimethyloctan-4-one |
|---|---|
| PubChem CID | 91164934 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 8-hydroxy-2,7-dimethyloctan-4-one |
| SMILES | CC(C)CC(=O)CCC(C)CO |
| InChI | InChI=1S/C10H20O2/c1-8(2)6-10(12)5-4-9(3)7-11/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | VWRBCATXIUXBFX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |