C25H34N2O6 — CID 91164973
(4S,5R)-18-hydroxy-4,5-dimethyl-16-(piperidin-4-ylmethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone (PubChem CID 91164973) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is (4S,5R)-18-hydroxy-4,5-dimethyl-16-(piperidin-4-ylmethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone.
| Compound Name | (4S,5R)-18-hydroxy-4,5-dimethyl-16-(piperidin-4-ylmethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
|---|---|
| PubChem CID | 91164973 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (4S,5R)-18-hydroxy-4,5-dimethyl-16-(piperidin-4-ylmethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
| SMILES | C[C@@H]1CCC(=O)C(=O)C(=O)CCCc2cc(NCC3CCNCC3)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C25H34N2O6/c1-15-6-7-21(29)24(31)20(28)5-3-4-18-12-19(27-14-17-8-10-26-11-9-17)13-22(30)23(18)25(32)33-16(15)2/h12-13,15-17,26-27,30H,3-11,14H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | JYUFANFOLIBGGN-CVEARBPZSA-N |
| XLogP | 2.81 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|