C22H32F2O6 — CID 91165152
[2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 5,6-ditert-butylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 91165152) has the molecular formula C22H32F2O6 and a molecular weight of 430.49 g/mol. Its IUPAC name is [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 5,6-ditert-butylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 5,6-ditert-butylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 91165152 |
| Molecular Formula | C22H32F2O6 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 5,6-ditert-butylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)C1C2CC(C(=O)OCC(=O)OC3CC(F)(F)OC3=O)C(C2)C1C(C)(C)C |
| InChI | InChI=1S/C22H32F2O6/c1-20(2,3)16-11-7-12(17(16)21(4,5)6)13(8-11)18(26)28-10-15(25)29-14-9-22(23,24)30-19(14)27/h11-14,16-17H,7-10H2,1-6H3 |
| InChIKey | UEIABSYUSHLMNU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|