C21H25F5O2 — CID 91165289
1-[6-(1,1,2,2,2-pentafluoroethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one (PubChem CID 91165289) has the molecular formula C21H25F5O2 and a molecular weight of 404.42 g/mol. Its IUPAC name is 1-[6-(1,1,2,2,2-pentafluoroethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one.
| Compound Name | 1-[6-(1,1,2,2,2-pentafluoroethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one |
|---|---|
| PubChem CID | 91165289 |
| Molecular Formula | C21H25F5O2 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[6-(1,1,2,2,2-pentafluoroethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one |
| SMILES | CCCC(CC(=O)C1OC2CCC1CC2C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H25F5O2/c1-2-6-14(13-7-4-3-5-8-13)12-17(27)19-15-9-10-18(28-19)16(11-15)20(22,23)21(24,25)26/h3-5,7-8,14-16,18-19H,2,6,9-12H2,1H3 |
| InChIKey | GCGKXFOQWDOLBQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|