About (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate
(1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate (PubChem CID 91165351) has the molecular formula C20H42NO3S+
and a molecular weight of 376.63 g/mol. Its IUPAC name is (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate.
Molecular Properties
| Compound Name | (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate |
| PubChem CID | 91165351 |
| Molecular Formula | C20H42NO3S+ |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)O[N+]1(CCCCCCC)CCCCC1 |
| InChI | InChI=1S/C20H42NO3S/c1-3-5-7-9-11-16-20-25(22,23)24-21(18-14-12-15-19-21)17-13-10-8-6-4-2/h3-20H2,1-2H3/q+1 |
| InChIKey | RKDFDSLUVYOIIM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate?
The IUPAC name of (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate (CID 91165351) is (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate.
What is the SMILES notation for (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate?
The canonical SMILES for (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate is CCCCCCCCS(=O)(=O)O[N+]1(CCCCCCC)CCCCC1.
What is the InChIKey of (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate?
The InChIKey is RKDFDSLUVYOIIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42NO3S/c1-3-5-7-9-11-16-20-25(22,23)24-21(18-14-12-15-19-21)17-13-10-8-6-4-2/h3-20H2,1-2H3/q+1.
What are the key properties of (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate?
(1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate has a molecular weight of 376.63 g/mol, XLogP of 5.58, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-heptylpiperidin-1-ium-1-yl) octane-1-sulfonate is sourced from PubChem (CID 91165351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).