C18H26ClF — CID 91165582
3-[2-(1-chloropropan-2-yl)hepta-2,4-dienyl]-5-fluoro-1,6-dimethylcyclohexa-1,3-diene (PubChem CID 91165582) has the molecular formula C18H26ClF and a molecular weight of 296.86 g/mol. Its IUPAC name is 3-[2-(1-chloropropan-2-yl)hepta-2,4-dienyl]-5-fluoro-1,6-dimethylcyclohexa-1,3-diene.
| Compound Name | 3-[2-(1-chloropropan-2-yl)hepta-2,4-dienyl]-5-fluoro-1,6-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 91165582 |
| Molecular Formula | C18H26ClF |
| Molecular Weight | 296.86 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-[2-(1-chloropropan-2-yl)hepta-2,4-dienyl]-5-fluoro-1,6-dimethylcyclohexa-1,3-diene |
| SMILES | CCC=CC=C(CC1=CC(F)C(C)C(C)=C1)C(C)CCl |
| InChI | InChI=1S/C18H26ClF/c1-5-6-7-8-17(14(3)12-19)10-16-9-13(2)15(4)18(20)11-16/h6-9,11,14-15,18H,5,10,12H2,1-4H3 |
| InChIKey | LCZCSUJRHKUBLM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.86 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|