C17H16ClF3N4 — CID 91165708
4-[6-chloro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-5-isocyano-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 91165708) has the molecular formula C17H16ClF3N4 and a molecular weight of 368.79 g/mol. Its IUPAC name is 4-[6-chloro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-5-isocyano-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-[6-chloro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-5-isocyano-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 91165708 |
| Molecular Formula | C17H16ClF3N4 |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 4-[6-chloro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-5-isocyano-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1C(CCC)=Nc2[nH]ncc2C1C1=CC=CC(C(F)(F)F)C1Cl |
| InChI | InChI=1S/C17H16ClF3N4/c1-3-5-12-15(22-2)13(10-8-23-25-16(10)24-12)9-6-4-7-11(14(9)18)17(19,20)21/h4,6-8,11,13-15H,3,5H2,1H3,(H,23,25) |
| InChIKey | OUFXFSQJBWVHJX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|