About 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine
6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine (PubChem CID 91165967) has the molecular formula C14H23N3O2S
and a molecular weight of 297.42 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine.
Molecular Properties
| Compound Name | 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine |
| PubChem CID | 91165967 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine |
| SMILES | CCN1CCN(S(=O)(=O)C2=CN=CC(C)(C)C=C2)CC1 |
| InChI | InChI=1S/C14H23N3O2S/c1-4-16-7-9-17(10-8-16)20(18,19)13-5-6-14(2,3)12-15-11-13/h5-6,11-12H,4,7-10H2,1-3H3 |
| InChIKey | IXERHAAPILOWKY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine?
The IUPAC name of 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine (CID 91165967) is 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine.
What is the SMILES notation for 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine?
The canonical SMILES for 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine is CCN1CCN(S(=O)(=O)C2=CN=CC(C)(C)C=C2)CC1.
What is the InChIKey of 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine?
The InChIKey is IXERHAAPILOWKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2S/c1-4-16-7-9-17(10-8-16)20(18,19)13-5-6-14(2,3)12-15-11-13/h5-6,11-12H,4,7-10H2,1-3H3.
What are the key properties of 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine?
6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine has a molecular weight of 297.42 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-ethylpiperazin-1-yl)sulfonyl-3,3-dimethylazepine is sourced from PubChem (CID 91165967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).