C22H23FN2O5 — CID 91165975
4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 91165975) has the molecular formula C22H23FN2O5 and a molecular weight of 414.43 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91165975 |
| Molecular Formula | C22H23FN2O5 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCN2CCOCC2)CC1C(=O)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C22H23FN2O5/c23-16-3-1-15(2-4-16)13-17-5-6-19(30-17)20(26)18-14-25(22(28)21(18)27)8-7-24-9-11-29-12-10-24/h1-6,18H,7-14H2 |
| InChIKey | LUOJWSRNSSIFDD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|