About 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine
1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine (PubChem CID 91166453) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine.
Molecular Properties
| Compound Name | 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine |
| PubChem CID | 91166453 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine |
| SMILES | CCC1(C)N(C(C)(C)C)C1(C)CC |
| InChI | InChI=1S/C12H25N/c1-8-11(6)12(7,9-2)13(11)10(3,4)5/h8-9H2,1-7H3 |
| InChIKey | WYAXFYCKONWCAY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine?
The IUPAC name of 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine (CID 91166453) is 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine.
What is the SMILES notation for 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine?
The canonical SMILES for 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine is CCC1(C)N(C(C)(C)C)C1(C)CC.
What is the InChIKey of 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine?
The InChIKey is WYAXFYCKONWCAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N/c1-8-11(6)12(7,9-2)13(11)10(3,4)5/h8-9H2,1-7H3.
What are the key properties of 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine?
1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine has a molecular weight of 183.34 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2,3-diethyl-2,3-dimethylaziridine is sourced from PubChem (CID 91166453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).