About 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate
3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate (PubChem CID 91166630) has the molecular formula C14H28O3S2
and a molecular weight of 308.51 g/mol. Its IUPAC name is 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate.
Molecular Properties
| Compound Name | 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate |
| PubChem CID | 91166630 |
| Molecular Formula | C14H28O3S2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate |
| SMILES | CCCC(S)CCOC(=O)CC(O)CC(S)CCC |
| InChI | InChI=1S/C14H28O3S2/c1-3-5-12(18)7-8-17-14(16)10-11(15)9-13(19)6-4-2/h11-13,15,18-19H,3-10H2,1-2H3 |
| InChIKey | YJMKNQWBMDVUCI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate?
The IUPAC name of 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate (CID 91166630) is 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate.
What is the SMILES notation for 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate?
The canonical SMILES for 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate is CCCC(S)CCOC(=O)CC(O)CC(S)CCC.
What is the InChIKey of 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate?
The InChIKey is YJMKNQWBMDVUCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3S2/c1-3-5-12(18)7-8-17-14(16)10-11(15)9-13(19)6-4-2/h11-13,15,18-19H,3-10H2,1-2H3.
What are the key properties of 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate?
3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate has a molecular weight of 308.51 g/mol, XLogP of 3.26, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylhexyl 3-hydroxy-5-sulfanyloctanoate is sourced from PubChem (CID 91166630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).