C18H17ClFNO3S — CID 91167243
2-[(4-chlorophenyl)methyl]-1-(3-fluorophenyl)sulfonylpiperidin-4-one (PubChem CID 91167243) has the molecular formula C18H17ClFNO3S and a molecular weight of 381.86 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-(3-fluorophenyl)sulfonylpiperidin-4-one.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-(3-fluorophenyl)sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 91167243 |
| Molecular Formula | C18H17ClFNO3S |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-(3-fluorophenyl)sulfonylpiperidin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2cccc(F)c2)C(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H17ClFNO3S/c19-14-6-4-13(5-7-14)10-16-12-17(22)8-9-21(16)25(23,24)18-3-1-2-15(20)11-18/h1-7,11,16H,8-10,12H2 |
| InChIKey | HQCSAXIIROUACK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |