C14H23NO — CID 91167732
2,7,9,10-tetramethyl-2,3,6,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-4-one (PubChem CID 91167732) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2,7,9,10-tetramethyl-2,3,6,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-4-one.
| Compound Name | 2,7,9,10-tetramethyl-2,3,6,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-4-one |
|---|---|
| PubChem CID | 91167732 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2,7,9,10-tetramethyl-2,3,6,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-4-one |
| SMILES | CC1=C(C)C2CC(C)CC(=O)N2CC(C)C1 |
| InChI | InChI=1S/C14H23NO/c1-9-6-13-12(4)11(3)5-10(2)8-15(13)14(16)7-9/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | WMULMLGTSMKKKV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|