C6H9NO3S — CID 91167837
[2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol (PubChem CID 91167837) has the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. Its IUPAC name is [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol.
| Compound Name | [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol |
|---|---|
| PubChem CID | 91167837 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol |
| SMILES | CC(O)c1nc(C(O)O)cs1 |
| InChI | InChI=1S/C6H9NO3S/c1-3(8)5-7-4(2-11-5)6(9)10/h2-3,6,8-10H,1H3 |
| InChIKey | UHFRJJQAYMWUQB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|