About [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol
[2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol (PubChem CID 91167837) has the molecular formula C6H9NO3S
and a molecular weight of 175.21 g/mol. Its IUPAC name is [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol.
Molecular Properties
| Compound Name | [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol |
| PubChem CID | 91167837 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol |
| SMILES | CC(O)c1nc(C(O)O)cs1 |
| InChI | InChI=1S/C6H9NO3S/c1-3(8)5-7-4(2-11-5)6(9)10/h2-3,6,8-10H,1H3 |
| InChIKey | UHFRJJQAYMWUQB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol?
The IUPAC name of [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol (CID 91167837) is [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol.
What is the SMILES notation for [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol?
The canonical SMILES for [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol is CC(O)c1nc(C(O)O)cs1.
What is the InChIKey of [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol?
The InChIKey is UHFRJJQAYMWUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3S/c1-3(8)5-7-4(2-11-5)6(9)10/h2-3,6,8-10H,1H3.
What are the key properties of [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol?
[2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol has a molecular weight of 175.21 g/mol, XLogP of 0.18, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-hydroxyethyl)-1,3-thiazol-4-yl]methanediol is sourced from PubChem (CID 91167837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).