C25H32N2OS — CID 91167924
N-[(4-methylthiophen-2-yl)methyl]-3-[3-(5-pyridin-3-ylfuran-3-yl)butyl]cyclohexan-1-amine (PubChem CID 91167924) has the molecular formula C25H32N2OS and a molecular weight of 408.61 g/mol. Its IUPAC name is N-[(4-methylthiophen-2-yl)methyl]-3-[3-(5-pyridin-3-ylfuran-3-yl)butyl]cyclohexan-1-amine.
| Compound Name | N-[(4-methylthiophen-2-yl)methyl]-3-[3-(5-pyridin-3-ylfuran-3-yl)butyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 91167924 |
| Molecular Formula | C25H32N2OS |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[(4-methylthiophen-2-yl)methyl]-3-[3-(5-pyridin-3-ylfuran-3-yl)butyl]cyclohexan-1-amine |
| SMILES | Cc1csc(CNC2CCCC(CCC(C)c3coc(-c4cccnc4)c3)C2)c1 |
| InChI | InChI=1S/C25H32N2OS/c1-18-11-24(29-17-18)15-27-23-7-3-5-20(12-23)9-8-19(2)22-13-25(28-16-22)21-6-4-10-26-14-21/h4,6,10-11,13-14,16-17,19-20,23,27H,3,5,7-9,12,15H2,1-2H3 |
| InChIKey | TZVAVKVBXAWCRI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |