C21H18FN4O+ — CID 91168224
3-[2-(2-fluorophenyl)-2-methylpyrazol-2-ium-3-yl]-1-(3-methylphenyl)pyridazin-4-one (PubChem CID 91168224) has the molecular formula C21H18FN4O+ and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)-2-methylpyrazol-2-ium-3-yl]-1-(3-methylphenyl)pyridazin-4-one.
| Compound Name | 3-[2-(2-fluorophenyl)-2-methylpyrazol-2-ium-3-yl]-1-(3-methylphenyl)pyridazin-4-one |
|---|---|
| PubChem CID | 91168224 |
| Molecular Formula | C21H18FN4O+ |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-[2-(2-fluorophenyl)-2-methylpyrazol-2-ium-3-yl]-1-(3-methylphenyl)pyridazin-4-one |
| SMILES | Cc1cccc(-n2ccc(=O)c(C3=CC=N[N+]3(C)c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C21H18FN4O/c1-15-6-5-7-16(14-15)25-13-11-20(27)21(24-25)19-10-12-23-26(19,2)18-9-4-3-8-17(18)22/h3-14H,1-2H3/q+1 |
| InChIKey | DZZUTMOJFPJPLL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|