About (2R)-2-amino-N'-pentanoylpentanehydrazide
(2R)-2-amino-N'-pentanoylpentanehydrazide (PubChem CID 91168858) has the molecular formula C10H21N3O2
and a molecular weight of 215.30 g/mol. Its IUPAC name is (2R)-2-amino-N'-pentanoylpentanehydrazide.
Molecular Properties
| Compound Name | (2R)-2-amino-N'-pentanoylpentanehydrazide |
| PubChem CID | 91168858 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | (2R)-2-amino-N'-pentanoylpentanehydrazide |
| SMILES | CCCCC(=O)NNC(=O)[C@H](N)CCC |
| InChI | InChI=1S/C10H21N3O2/c1-3-5-7-9(14)12-13-10(15)8(11)6-4-2/h8H,3-7,11H2,1-2H3,(H,12,14)(H,13,15)/t8-/m1/s1 |
| InChIKey | HAEYJUQLFDRCBR-MRVPVSSYSA-N |
| XLogP | 0.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-N'-pentanoylpentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N'-pentanoylpentanehydrazide?
The IUPAC name of (2R)-2-amino-N'-pentanoylpentanehydrazide (CID 91168858) is (2R)-2-amino-N'-pentanoylpentanehydrazide.
What is the SMILES notation for (2R)-2-amino-N'-pentanoylpentanehydrazide?
The canonical SMILES for (2R)-2-amino-N'-pentanoylpentanehydrazide is CCCCC(=O)NNC(=O)[C@H](N)CCC.
What is the InChIKey of (2R)-2-amino-N'-pentanoylpentanehydrazide?
The InChIKey is HAEYJUQLFDRCBR-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H21N3O2/c1-3-5-7-9(14)12-13-10(15)8(11)6-4-2/h8H,3-7,11H2,1-2H3,(H,12,14)(H,13,15)/t8-/m1/s1.
What are the key properties of (2R)-2-amino-N'-pentanoylpentanehydrazide?
(2R)-2-amino-N'-pentanoylpentanehydrazide has a molecular weight of 215.30 g/mol, XLogP of 0.45, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N'-pentanoylpentanehydrazide is sourced from PubChem (CID 91168858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).