C18H17N2OS+ — CID 911689
6-(4-methoxyphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium (PubChem CID 911689) has the molecular formula C18H17N2OS+ and a molecular weight of 309.41 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium.
| Compound Name | 6-(4-methoxyphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium |
|---|---|
| PubChem CID | 911689 |
| Molecular Formula | C18H17N2OS+ |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 6-(4-methoxyphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium |
| SMILES | COc1ccc(-c2c[n+]3c(n2-c2ccccc2)SCC3)cc1 |
| InChI | InChI=1S/C18H17N2OS/c1-21-16-9-7-14(8-10-16)17-13-19-11-12-22-18(19)20(17)15-5-3-2-4-6-15/h2-10,13H,11-12H2,1H3/q+1 |
| InChIKey | ULIXOOTVKPGXGZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|