C8H4ClF5O3S — CID 91169095
2-chloro-3-(1,1,2,2,2-pentafluoroethoxy)benzenesulfinic acid (PubChem CID 91169095) has the molecular formula C8H4ClF5O3S and a molecular weight of 310.63 g/mol. Its IUPAC name is 2-chloro-3-(1,1,2,2,2-pentafluoroethoxy)benzenesulfinic acid.
| Compound Name | 2-chloro-3-(1,1,2,2,2-pentafluoroethoxy)benzenesulfinic acid |
|---|---|
| PubChem CID | 91169095 |
| Molecular Formula | C8H4ClF5O3S |
| Molecular Weight | 310.63 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | 2-chloro-3-(1,1,2,2,2-pentafluoroethoxy)benzenesulfinic acid |
| SMILES | O=S(O)c1cccc(OC(F)(F)C(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H4ClF5O3S/c9-6-4(2-1-3-5(6)18(15)16)17-8(13,14)7(10,11)12/h1-3H,(H,15,16) |
| InChIKey | WSXPJPWWZICXTB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|