About diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium
diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium (PubChem CID 911691) has the molecular formula C13H16NS2+
and a molecular weight of 250.41 g/mol. Its IUPAC name is diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium.
Molecular Properties
| Compound Name | diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium |
| PubChem CID | 911691 |
| Molecular Formula | C13H16NS2+ |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium |
| SMILES | CC[N+](CC)=c1scc(-c2ccccc2)s1 |
| InChI | InChI=1S/C13H16NS2/c1-3-14(4-2)13-15-10-12(16-13)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3/q+1 |
| InChIKey | YVCOSGXKTLWLJS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium?
The IUPAC name of diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium (CID 911691) is diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium.
What is the SMILES notation for diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium?
The canonical SMILES for diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium is CC[N+](CC)=c1scc(-c2ccccc2)s1.
What is the InChIKey of diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium?
The InChIKey is YVCOSGXKTLWLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16NS2/c1-3-14(4-2)13-15-10-12(16-13)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3/q+1.
What are the key properties of diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium?
diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium has a molecular weight of 250.41 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-(4-phenyl-1,3-dithiol-2-ylidene)azanium is sourced from PubChem (CID 911691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).